C31H35F3N6O5 — CID 135389161
3-[2-[4-[2-amino-8-[[4-(trifluoromethoxy)phenyl]methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxy]-N-hydroxycyclobutane-1-carboxamide (PubChem CID 135389161) has the molecular formula C31H35F3N6O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is 3-[2-[4-[2-amino-8-[[4-(trifluoromethoxy)phenyl]methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxy]-N-hydroxycyclobutane-1-carboxamide.
| Compound Name | 3-[2-[4-[2-amino-8-[[4-(trifluoromethoxy)phenyl]methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxy]-N-hydroxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 135389161 |
| Molecular Formula | C31H35F3N6O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 3-[2-[4-[2-amino-8-[[4-(trifluoromethoxy)phenyl]methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxy]-N-hydroxycyclobutane-1-carboxamide |
| SMILES | Nc1nc2c(c(N3CCN(CCOC4CC(C(=O)NO)C4)CC3)n1)CCc1cc(OCc3ccc(OC(F)(F)F)cc3)ccc1-2 |
| InChI | InChI=1S/C31H35F3N6O5/c32-31(33,34)45-22-4-1-19(2-5-22)18-44-23-6-8-25-20(15-23)3-7-26-27(25)36-30(35)37-28(26)40-11-9-39(10-12-40)13-14-43-24-16-21(17-24)29(41)38-42/h1-2,4-6,8,15,21,24,42H,3,7,9-14,16-18H2,(H,38,41)(H2,35,36,37) |
| InChIKey | OAJCKMIBUYQFPL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|