About Example 6
Example 6 (PubChem CID 135389219) has the molecular formula C21H18F4N6O
and a molecular weight of 446.40 g/mol. Its IUPAC name is 2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile.
Molecular Properties
| Compound Name | Example 6 |
| PubChem CID | 135389219 |
| Molecular Formula | C21H18F4N6O |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile |
| SMILES | C1COCCC1NC2=NC=CC(=N2)N3C(=CN=C3C4=CC(=C(C=C4)F)C(F)(F)F)CC#N |
| InChI | InChI=1S/C21H18F4N6O/c22-17-2-1-13(11-16(17)21(23,24)25)19-28-12-15(3-7-26)31(19)18-4-8-27-20(30-18)29-14-5-9-32-10-6-14/h1-2,4,8,11-12,14H,3,5-6,9-10H2,(H,27,29,30) |
| InChIKey | QUAMEPWGALLEMV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | 666 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze Example 6 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Example 6?
The IUPAC name of Example 6 (CID 135389219) is 2-[2-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile.
What is the SMILES notation for Example 6?
The canonical SMILES for Example 6 is C1COCCC1NC2=NC=CC(=N2)N3C(=CN=C3C4=CC(=C(C=C4)F)C(F)(F)F)CC#N.
What is the InChIKey of Example 6?
The InChIKey is QUAMEPWGALLEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F4N6O/c22-17-2-1-13(11-16(17)21(23,24)25)19-28-12-15(3-7-26)31(19)18-4-8-27-20(30-18)29-14-5-9-32-10-6-14/h1-2,4,8,11-12,14H,3,5-6,9-10H2,(H,27,29,30).
What are the key properties of Example 6?
Example 6 has a molecular weight of 446.40 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Example 6 is sourced from PubChem (CID 135389219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).