About 3,6-dimethylidenecyclohexene;methanediimine
3,6-dimethylidenecyclohexene;methanediimine (PubChem CID 135389263) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3,6-dimethylidenecyclohexene;methanediimine.
Molecular Properties
| Compound Name | 3,6-dimethylidenecyclohexene;methanediimine |
| PubChem CID | 135389263 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3,6-dimethylidenecyclohexene;methanediimine |
| SMILES | C=C1C=CC(=C)CC1.N=C=N |
| InChI | InChI=1S/C8H10.CH2N2/c1-7-3-5-8(2)6-4-7;2-1-3/h3,5H,1-2,4,6H2;2-3H |
| InChIKey | KVZXULCAEHJMNQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethylidenecyclohexene;methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylidenecyclohexene;methanediimine?
The IUPAC name of 3,6-dimethylidenecyclohexene;methanediimine (CID 135389263) is 3,6-dimethylidenecyclohexene;methanediimine.
What is the SMILES notation for 3,6-dimethylidenecyclohexene;methanediimine?
The canonical SMILES for 3,6-dimethylidenecyclohexene;methanediimine is C=C1C=CC(=C)CC1.N=C=N.
What is the InChIKey of 3,6-dimethylidenecyclohexene;methanediimine?
The InChIKey is KVZXULCAEHJMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.CH2N2/c1-7-3-5-8(2)6-4-7;2-1-3/h3,5H,1-2,4,6H2;2-3H.
What are the key properties of 3,6-dimethylidenecyclohexene;methanediimine?
3,6-dimethylidenecyclohexene;methanediimine has a molecular weight of 148.21 g/mol, XLogP of 2.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylidenecyclohexene;methanediimine is sourced from PubChem (CID 135389263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).