About butyl 2-hydroxypropanoate;oxolan-2-ylmethanol
butyl 2-hydroxypropanoate;oxolan-2-ylmethanol (PubChem CID 135389284) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is butyl 2-hydroxypropanoate;oxolan-2-ylmethanol.
Molecular Properties
| Compound Name | butyl 2-hydroxypropanoate;oxolan-2-ylmethanol |
| PubChem CID | 135389284 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | butyl 2-hydroxypropanoate;oxolan-2-ylmethanol |
| SMILES | CCCCOC(=O)C(C)O.OCC1CCCO1 |
| InChI | InChI=1S/C7H14O3.C5H10O2/c1-3-4-5-10-7(9)6(2)8;6-4-5-2-1-3-7-5/h6,8H,3-5H2,1-2H3;5-6H,1-4H2 |
| InChIKey | MDSXXFWTRSJNEY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-hydroxypropanoate;oxolan-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-hydroxypropanoate;oxolan-2-ylmethanol?
The IUPAC name of butyl 2-hydroxypropanoate;oxolan-2-ylmethanol (CID 135389284) is butyl 2-hydroxypropanoate;oxolan-2-ylmethanol.
What is the SMILES notation for butyl 2-hydroxypropanoate;oxolan-2-ylmethanol?
The canonical SMILES for butyl 2-hydroxypropanoate;oxolan-2-ylmethanol is CCCCOC(=O)C(C)O.OCC1CCCO1.
What is the InChIKey of butyl 2-hydroxypropanoate;oxolan-2-ylmethanol?
The InChIKey is MDSXXFWTRSJNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C5H10O2/c1-3-4-5-10-7(9)6(2)8;6-4-5-2-1-3-7-5/h6,8H,3-5H2,1-2H3;5-6H,1-4H2.
What are the key properties of butyl 2-hydroxypropanoate;oxolan-2-ylmethanol?
butyl 2-hydroxypropanoate;oxolan-2-ylmethanol has a molecular weight of 248.32 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-hydroxypropanoate;oxolan-2-ylmethanol is sourced from PubChem (CID 135389284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).