About 3-isocyanatohex-1-ene
3-isocyanatohex-1-ene (PubChem CID 135390003) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3-isocyanatohex-1-ene.
Molecular Properties
| Compound Name | 3-isocyanatohex-1-ene |
| PubChem CID | 135390003 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3-isocyanatohex-1-ene |
| SMILES | C=CC(CCC)N=C=O |
| InChI | InChI=1S/C7H11NO/c1-3-5-7(4-2)8-6-9/h4,7H,2-3,5H2,1H3 |
| InChIKey | UKDBVVUBMOCSAV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanatohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanatohex-1-ene?
The IUPAC name of 3-isocyanatohex-1-ene (CID 135390003) is 3-isocyanatohex-1-ene.
What is the SMILES notation for 3-isocyanatohex-1-ene?
The canonical SMILES for 3-isocyanatohex-1-ene is C=CC(CCC)N=C=O.
What is the InChIKey of 3-isocyanatohex-1-ene?
The InChIKey is UKDBVVUBMOCSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-5-7(4-2)8-6-9/h4,7H,2-3,5H2,1H3.
What are the key properties of 3-isocyanatohex-1-ene?
3-isocyanatohex-1-ene has a molecular weight of 125.17 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanatohex-1-ene is sourced from PubChem (CID 135390003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).