C30H42BrN3O4S — CID 135390085
(2S,4R)-1-[(2R)-2-(6-bromohexanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[(1S)-1-[4-(3-methylthiophen-2-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 135390085) has the molecular formula C30H42BrN3O4S and a molecular weight of 620.65 g/mol. Its IUPAC name is (2S,4R)-1-[(2R)-2-(6-bromohexanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[(1S)-1-[4-(3-methylthiophen-2-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2R)-2-(6-bromohexanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[(1S)-1-[4-(3-methylthiophen-2-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135390085 |
| Molecular Formula | C30H42BrN3O4S |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | (2S,4R)-1-[(2R)-2-(6-bromohexanoylamino)-3,3-dimethylbutanoyl]-4-hydroxy-N-[(1S)-1-[4-(3-methylthiophen-2-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@H](NC(=O)CCCCCBr)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H42BrN3O4S/c1-19-14-16-39-26(19)22-12-10-21(11-13-22)20(2)32-28(37)24-17-23(35)18-34(24)29(38)27(30(3,4)5)33-25(36)9-7-6-8-15-31/h10-14,16,20,23-24,27,35H,6-9,15,17-18H2,1-5H3,(H,32,37)(H,33,36)/t20-,23+,24-,27-/m0/s1 |
| InChIKey | DXGYSJZEALUMSD-YQJHKJFNSA-N |
| XLogP | 5.35 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|