About cyclopentadecane-1,5-dicarbaldehyde
cyclopentadecane-1,5-dicarbaldehyde (PubChem CID 135390185) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is cyclopentadecane-1,5-dicarbaldehyde.
Molecular Properties
| Compound Name | cyclopentadecane-1,5-dicarbaldehyde |
| PubChem CID | 135390185 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | cyclopentadecane-1,5-dicarbaldehyde |
| SMILES | O=CC1CCCCCCCCCCC(C=O)CCC1 |
| InChI | InChI=1S/C17H30O2/c18-14-16-10-7-5-3-1-2-4-6-8-11-17(15-19)13-9-12-16/h14-17H,1-13H2 |
| InChIKey | XDSRQQVPOPRVKL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclopentadecane-1,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentadecane-1,5-dicarbaldehyde?
The IUPAC name of cyclopentadecane-1,5-dicarbaldehyde (CID 135390185) is cyclopentadecane-1,5-dicarbaldehyde.
What is the SMILES notation for cyclopentadecane-1,5-dicarbaldehyde?
The canonical SMILES for cyclopentadecane-1,5-dicarbaldehyde is O=CC1CCCCCCCCCCC(C=O)CCC1.
What is the InChIKey of cyclopentadecane-1,5-dicarbaldehyde?
The InChIKey is XDSRQQVPOPRVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c18-14-16-10-7-5-3-1-2-4-6-8-11-17(15-19)13-9-12-16/h14-17H,1-13H2.
What are the key properties of cyclopentadecane-1,5-dicarbaldehyde?
cyclopentadecane-1,5-dicarbaldehyde has a molecular weight of 266.42 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentadecane-1,5-dicarbaldehyde is sourced from PubChem (CID 135390185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).