C23H26F3NO4 — CID 135390218
4-[6-[2-[4-(trifluoromethyl)phenoxy]ethoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid (PubChem CID 135390218) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 4-[6-[2-[4-(trifluoromethyl)phenoxy]ethoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid.
| Compound Name | 4-[6-[2-[4-(trifluoromethyl)phenoxy]ethoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 135390218 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-[6-[2-[4-(trifluoromethyl)phenoxy]ethoxy]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCc2cccc(OCCOc3ccc(C(F)(F)F)cc3)c2CC1 |
| InChI | InChI=1S/C23H26F3NO4/c24-23(25,26)18-6-8-19(9-7-18)30-15-16-31-21-4-1-3-17-10-13-27(14-11-20(17)21)12-2-5-22(28)29/h1,3-4,6-9H,2,5,10-16H2,(H,28,29) |
| InChIKey | LZSQMUDNVRKGEJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|