C21H26N6OS — CID 135390267
N-[3-(dimethylamino)propyl]-7-(3,3-dimethyl-2H-indol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide (PubChem CID 135390267) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-7-(3,3-dimethyl-2H-indol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-7-(3,3-dimethyl-2H-indol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135390267 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-7-(3,3-dimethyl-2H-indol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1nc2c(N3CC(C)(C)c4ccccc43)ncnc2s1 |
| InChI | InChI=1S/C21H26N6OS/c1-21(2)12-27(15-9-6-5-8-14(15)21)17-16-19(24-13-23-17)29-20(25-16)18(28)22-10-7-11-26(3)4/h5-6,8-9,13H,7,10-12H2,1-4H3,(H,22,28) |
| InChIKey | LVSWSCZOVNFBCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|