About 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane
2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane (PubChem CID 135390944) has the molecular formula C12H22OS
and a molecular weight of 214.37 g/mol. Its IUPAC name is 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane |
| PubChem CID | 135390944 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane |
| SMILES | CC/C=C/CC1OCCC(CCC)S1 |
| InChI | InChI=1S/C12H22OS/c1-3-5-6-8-12-13-10-9-11(14-12)7-4-2/h5-6,11-12H,3-4,7-10H2,1-2H3/b6-5+ |
| InChIKey | IGYARXKLMXBWKO-AATRIKPKSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane?
The IUPAC name of 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane (CID 135390944) is 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane.
What is the SMILES notation for 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane?
The canonical SMILES for 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane is CC/C=C/CC1OCCC(CCC)S1.
What is the InChIKey of 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane?
The InChIKey is IGYARXKLMXBWKO-AATRIKPKSA-N. The full InChI is InChI=1S/C12H22OS/c1-3-5-6-8-12-13-10-9-11(14-12)7-4-2/h5-6,11-12H,3-4,7-10H2,1-2H3/b6-5+.
What are the key properties of 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane?
2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane has a molecular weight of 214.37 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-pent-2-enyl]-4-propyl-1,3-oxathiane is sourced from PubChem (CID 135390944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).