C48H56MnN12+5 — CID 135391028
manganese(3+);5,10,15-tris(1,3-diethylimidazol-1-ium-2-yl)-20-(1,3-diethylimidazol-2-ylidene)porphyrin-22-ide (PubChem CID 135391028) has the molecular formula C48H56MnN12+5 and a molecular weight of 856.00 g/mol. Its IUPAC name is manganese(3+);5,10,15-tris(1,3-diethylimidazol-1-ium-2-yl)-20-(1,3-diethylimidazol-2-ylidene)porphyrin-22-ide.
| Compound Name | manganese(3+);5,10,15-tris(1,3-diethylimidazol-1-ium-2-yl)-20-(1,3-diethylimidazol-2-ylidene)porphyrin-22-ide |
|---|---|
| PubChem CID | 135391028 |
| Molecular Formula | C48H56MnN12+5 |
| Molecular Weight | 856.00 g/mol |
| Exact Mass | 855.41 |
| IUPAC Name | manganese(3+);5,10,15-tris(1,3-diethylimidazol-1-ium-2-yl)-20-(1,3-diethylimidazol-2-ylidene)porphyrin-22-ide |
| SMILES | CCN1C=CN(CC)C1=C1C2=N/C(=C(/c3n(CC)cc[n+]3CC)C3=N/C(=C(/c4n(CC)cc[n+]4CC)c4ccc([n-]4)/C(c4n(CC)cc[n+]4CC)=C4/C=CC1=N4)C=C3)C=C2.[Mn+3] |
| InChI | InChI=1S/C48H56N12.Mn/c1-9-53-25-26-54(10-2)45(53)41-33-17-19-35(49-33)42(46-55(11-3)27-28-56(46)12-4)37-21-23-39(51-37)44(48-59(15-7)31-32-60(48)16-8)40-24-22-38(52-40)43(36-20-18-34(41)50-36)47-57(13-5)29-30-58(47)14-6;/h17-32H,9-16H2,1-8H3;/q+2;+3 |
| InChIKey | XPJDUEMHUTZIJZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 84.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|