About 2-fluoro-N,N-dimethylpentanamide
2-fluoro-N,N-dimethylpentanamide (PubChem CID 135391133) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethylpentanamide |
| PubChem CID | 135391133 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 2-fluoro-N,N-dimethylpentanamide |
| SMILES | CCCC(F)C(=O)N(C)C |
| InChI | InChI=1S/C7H14FNO/c1-4-5-6(8)7(10)9(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | WMZMILZERPOBJW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-N,N-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethylpentanamide?
The IUPAC name of 2-fluoro-N,N-dimethylpentanamide (CID 135391133) is 2-fluoro-N,N-dimethylpentanamide.
What is the SMILES notation for 2-fluoro-N,N-dimethylpentanamide?
The canonical SMILES for 2-fluoro-N,N-dimethylpentanamide is CCCC(F)C(=O)N(C)C.
What is the InChIKey of 2-fluoro-N,N-dimethylpentanamide?
The InChIKey is WMZMILZERPOBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FNO/c1-4-5-6(8)7(10)9(2)3/h6H,4-5H2,1-3H3.
What are the key properties of 2-fluoro-N,N-dimethylpentanamide?
2-fluoro-N,N-dimethylpentanamide has a molecular weight of 147.19 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethylpentanamide is sourced from PubChem (CID 135391133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).