About 1-cyclohexyl-2,3-dimethylbutane-2,3-diol
1-cyclohexyl-2,3-dimethylbutane-2,3-diol (PubChem CID 135391283) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-dimethylbutane-2,3-diol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,3-dimethylbutane-2,3-diol |
| PubChem CID | 135391283 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-cyclohexyl-2,3-dimethylbutane-2,3-diol |
| SMILES | CC(C)(O)C(C)(O)CC1CCCCC1 |
| InChI | InChI=1S/C12H24O2/c1-11(2,13)12(3,14)9-10-7-5-4-6-8-10/h10,13-14H,4-9H2,1-3H3 |
| InChIKey | STJCSXGKVXIPEF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-2,3-dimethylbutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,3-dimethylbutane-2,3-diol?
The IUPAC name of 1-cyclohexyl-2,3-dimethylbutane-2,3-diol (CID 135391283) is 1-cyclohexyl-2,3-dimethylbutane-2,3-diol.
What is the SMILES notation for 1-cyclohexyl-2,3-dimethylbutane-2,3-diol?
The canonical SMILES for 1-cyclohexyl-2,3-dimethylbutane-2,3-diol is CC(C)(O)C(C)(O)CC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,3-dimethylbutane-2,3-diol?
The InChIKey is STJCSXGKVXIPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-11(2,13)12(3,14)9-10-7-5-4-6-8-10/h10,13-14H,4-9H2,1-3H3.
What are the key properties of 1-cyclohexyl-2,3-dimethylbutane-2,3-diol?
1-cyclohexyl-2,3-dimethylbutane-2,3-diol has a molecular weight of 200.32 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,3-dimethylbutane-2,3-diol is sourced from PubChem (CID 135391283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).