About (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal
(2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal (PubChem CID 135391399) has the molecular formula C16H30O2Si
and a molecular weight of 282.50 g/mol. Its IUPAC name is (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal.
Molecular Properties
| Compound Name | (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal |
| PubChem CID | 135391399 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal |
| SMILES | C=CCC/C=C(/C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-8-9-10-11-16(12-17)18-19(13(2)3,14(4)5)15(6)7/h8,11-15H,1,9-10H2,2-7H3/b16-11- |
| InChIKey | GNOGZVMYPGAYQN-WJDWOHSUSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal?
The IUPAC name of (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal (CID 135391399) is (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal.
What is the SMILES notation for (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal?
The canonical SMILES for (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal is C=CCC/C=C(/C=O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal?
The InChIKey is GNOGZVMYPGAYQN-WJDWOHSUSA-N. The full InChI is InChI=1S/C16H30O2Si/c1-8-9-10-11-16(12-17)18-19(13(2)3,14(4)5)15(6)7/h8,11-15H,1,9-10H2,2-7H3/b16-11-.
What are the key properties of (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal?
(2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal has a molecular weight of 282.50 g/mol, XLogP of 5.23, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-tri(propan-2-yl)silyloxyhepta-2,6-dienal is sourced from PubChem (CID 135391399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).