C18H34N4O7 — CID 135391836
2,8-diamino-2,8-bis(4-aminobutyl)-4-(hydroxymethyl)-3,7-dioxononanedioic acid (PubChem CID 135391836) has the molecular formula C18H34N4O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2,8-diamino-2,8-bis(4-aminobutyl)-4-(hydroxymethyl)-3,7-dioxononanedioic acid.
| Compound Name | 2,8-diamino-2,8-bis(4-aminobutyl)-4-(hydroxymethyl)-3,7-dioxononanedioic acid |
|---|---|
| PubChem CID | 135391836 |
| Molecular Formula | C18H34N4O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2,8-diamino-2,8-bis(4-aminobutyl)-4-(hydroxymethyl)-3,7-dioxononanedioic acid |
| SMILES | NCCCCC(N)(C(=O)O)C(=O)CCC(CO)C(=O)C(N)(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H34N4O7/c19-9-3-1-7-17(21,15(26)27)13(24)6-5-12(11-23)14(25)18(22,16(28)29)8-2-4-10-20/h12,23H,1-11,19-22H2,(H,26,27)(H,28,29) |
| InChIKey | KHNBKVSTGIBBJY-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 233.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|