C26H42N2+2 — CID 135391858
2,4,6-trimethyl-1-[10-(2,4,6-trimethylpyridin-1-ium-1-yl)decyl]pyridin-1-ium (PubChem CID 135391858) has the molecular formula C26H42N2+2 and a molecular weight of 382.64 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-[10-(2,4,6-trimethylpyridin-1-ium-1-yl)decyl]pyridin-1-ium.
| Compound Name | 2,4,6-trimethyl-1-[10-(2,4,6-trimethylpyridin-1-ium-1-yl)decyl]pyridin-1-ium |
|---|---|
| PubChem CID | 135391858 |
| Molecular Formula | C26H42N2+2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | 2,4,6-trimethyl-1-[10-(2,4,6-trimethylpyridin-1-ium-1-yl)decyl]pyridin-1-ium |
| SMILES | Cc1cc(C)[n+](CCCCCCCCCC[n+]2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C26H42N2/c1-21-17-23(3)27(24(4)18-21)15-13-11-9-7-8-10-12-14-16-28-25(5)19-22(2)20-26(28)6/h17-20H,7-16H2,1-6H3/q+2 |
| InChIKey | XXSQLGMGUKLJOP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|