About S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate
S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate (PubChem CID 135391863) has the molecular formula C26H31NO2S
and a molecular weight of 421.61 g/mol. Its IUPAC name is S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate.
Molecular Properties
| Compound Name | S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate |
| PubChem CID | 135391863 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate |
| SMILES | CCCCCCCCc1c(-c2ccccc2)c(=O)c2ccccc2n1CC(=O)SC |
| InChI | InChI=1S/C26H31NO2S/c1-3-4-5-6-7-11-18-23-25(20-14-9-8-10-15-20)26(29)21-16-12-13-17-22(21)27(23)19-24(28)30-2/h8-10,12-17H,3-7,11,18-19H2,1-2H3 |
| InChIKey | CAIFWLVHQNTUSM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate?
The IUPAC name of S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate (CID 135391863) is S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate.
What is the SMILES notation for S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate?
The canonical SMILES for S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate is CCCCCCCCc1c(-c2ccccc2)c(=O)c2ccccc2n1CC(=O)SC.
What is the InChIKey of S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate?
The InChIKey is CAIFWLVHQNTUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO2S/c1-3-4-5-6-7-11-18-23-25(20-14-9-8-10-15-20)26(29)21-16-12-13-17-22(21)27(23)19-24(28)30-2/h8-10,12-17H,3-7,11,18-19H2,1-2H3.
What are the key properties of S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate?
S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate has a molecular weight of 421.61 g/mol, XLogP of 6.46, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2-(2-octyl-4-oxo-3-phenylquinolin-1-yl)ethanethioate is sourced from PubChem (CID 135391863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).