C28H24N2O — CID 135391900
(1S)-N,N,1-triphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 135391900) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is (1S)-N,N,1-triphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (1S)-N,N,1-triphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 135391900 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (1S)-N,N,1-triphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(N(c1ccccc1)c1ccccc1)N1CCc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H24N2O/c31-28(30(24-15-6-2-7-16-24)25-17-8-3-9-18-25)29-21-20-22-12-10-11-19-26(22)27(29)23-13-4-1-5-14-23/h1-19,27H,20-21H2/t27-/m0/s1 |
| InChIKey | CWCWPHODRGZFMY-MHZLTWQESA-N |
| XLogP | 6.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |