About methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate
methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate (PubChem CID 135391964) has the molecular formula C23H16F3IO5S
and a molecular weight of 588.34 g/mol. Its IUPAC name is methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate.
Molecular Properties
| Compound Name | methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate |
| PubChem CID | 135391964 |
| Molecular Formula | C23H16F3IO5S |
| Molecular Weight | 588.34 g/mol |
| Exact Mass | 587.97 |
| IUPAC Name | methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate |
| SMILES | COC(=O)c1cc2c(I)c(OS(=O)(=O)C(F)(F)F)c3cccc(C)c3c2c2c(C)cccc12 |
| InChI | InChI=1S/C23H16F3IO5S/c1-11-6-4-8-13-15(22(28)31-3)10-16-19(17(11)13)18-12(2)7-5-9-14(18)21(20(16)27)32-33(29,30)23(24,25)26/h4-10H,1-3H3 |
| InChIKey | IKGJZWIPWDDUCR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate?
The IUPAC name of methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate (CID 135391964) is methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate.
What is the SMILES notation for methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate?
The canonical SMILES for methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate is COC(=O)c1cc2c(I)c(OS(=O)(=O)C(F)(F)F)c3cccc(C)c3c2c2c(C)cccc12.
What is the InChIKey of methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate?
The InChIKey is IKGJZWIPWDDUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F3IO5S/c1-11-6-4-8-13-15(22(28)31-3)10-16-19(17(11)13)18-12(2)7-5-9-14(18)21(20(16)27)32-33(29,30)23(24,25)26/h4-10H,1-3H3.
What are the key properties of methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate?
methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate has a molecular weight of 588.34 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-iodo-1,12-dimethyl-5-(trifluoromethylsulfonyloxy)benzo[c]phenanthrene-8-carboxylate is sourced from PubChem (CID 135391964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).