About 3-methylthieno[3,2-b]pyridine-7-carbonitrile
3-methylthieno[3,2-b]pyridine-7-carbonitrile (PubChem CID 135392199) has the molecular formula C9H6N2S
and a molecular weight of 174.23 g/mol. Its IUPAC name is 3-methylthieno[3,2-b]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 3-methylthieno[3,2-b]pyridine-7-carbonitrile |
| PubChem CID | 135392199 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 3-methylthieno[3,2-b]pyridine-7-carbonitrile |
| SMILES | Cc1csc2c(C#N)ccnc12 |
| InChI | InChI=1S/C9H6N2S/c1-6-5-12-9-7(4-10)2-3-11-8(6)9/h2-3,5H,1H3 |
| InChIKey | RXURDCLDNKORCA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylthieno[3,2-b]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylthieno[3,2-b]pyridine-7-carbonitrile?
The IUPAC name of 3-methylthieno[3,2-b]pyridine-7-carbonitrile (CID 135392199) is 3-methylthieno[3,2-b]pyridine-7-carbonitrile.
What is the SMILES notation for 3-methylthieno[3,2-b]pyridine-7-carbonitrile?
The canonical SMILES for 3-methylthieno[3,2-b]pyridine-7-carbonitrile is Cc1csc2c(C#N)ccnc12.
What is the InChIKey of 3-methylthieno[3,2-b]pyridine-7-carbonitrile?
The InChIKey is RXURDCLDNKORCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S/c1-6-5-12-9-7(4-10)2-3-11-8(6)9/h2-3,5H,1H3.
What are the key properties of 3-methylthieno[3,2-b]pyridine-7-carbonitrile?
3-methylthieno[3,2-b]pyridine-7-carbonitrile has a molecular weight of 174.23 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylthieno[3,2-b]pyridine-7-carbonitrile is sourced from PubChem (CID 135392199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).