About 2-methyl-1,5-dioxaspiro[2.3]hexane
2-methyl-1,5-dioxaspiro[2.3]hexane (PubChem CID 135392637) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is 2-methyl-1,5-dioxaspiro[2.3]hexane.
Molecular Properties
| Compound Name | 2-methyl-1,5-dioxaspiro[2.3]hexane |
| PubChem CID | 135392637 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 2-methyl-1,5-dioxaspiro[2.3]hexane |
| SMILES | CC1OC12COC2 |
| InChI | InChI=1S/C5H8O2/c1-4-5(7-4)2-6-3-5/h4H,2-3H2,1H3 |
| InChIKey | YLUOSSRQFDVQGT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,5-dioxaspiro[2.3]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,5-dioxaspiro[2.3]hexane?
The IUPAC name of 2-methyl-1,5-dioxaspiro[2.3]hexane (CID 135392637) is 2-methyl-1,5-dioxaspiro[2.3]hexane.
What is the SMILES notation for 2-methyl-1,5-dioxaspiro[2.3]hexane?
The canonical SMILES for 2-methyl-1,5-dioxaspiro[2.3]hexane is CC1OC12COC2.
What is the InChIKey of 2-methyl-1,5-dioxaspiro[2.3]hexane?
The InChIKey is YLUOSSRQFDVQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2/c1-4-5(7-4)2-6-3-5/h4H,2-3H2,1H3.
What are the key properties of 2-methyl-1,5-dioxaspiro[2.3]hexane?
2-methyl-1,5-dioxaspiro[2.3]hexane has a molecular weight of 100.12 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,5-dioxaspiro[2.3]hexane is sourced from PubChem (CID 135392637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).