About 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride
8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride (PubChem CID 135392876) has the molecular formula C6H11ClN2O2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride.
Molecular Properties
| Compound Name | 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride |
| PubChem CID | 135392876 |
| Molecular Formula | C6H11ClN2O2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride |
| SMILES | Cl.O=C1COCC2(CNC2)N1 |
| InChI | InChI=1S/C6H10N2O2.ClH/c9-5-1-10-4-6(8-5)2-7-3-6;/h7H,1-4H2,(H,8,9);1H |
| InChIKey | CLOCXGSKSYGXAX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride?
The IUPAC name of 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride (CID 135392876) is 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride.
What is the SMILES notation for 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride?
The canonical SMILES for 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride is Cl.O=C1COCC2(CNC2)N1.
What is the InChIKey of 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride?
The InChIKey is CLOCXGSKSYGXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.ClH/c9-5-1-10-4-6(8-5)2-7-3-6;/h7H,1-4H2,(H,8,9);1H.
What are the key properties of 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride?
8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of -1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride is sourced from PubChem (CID 135392876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).