About 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride
2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride (PubChem CID 135393059) has the molecular formula C7H16Cl2N2
and a molecular weight of 199.12 g/mol. Its IUPAC name is 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride |
| PubChem CID | 135393059 |
| Molecular Formula | C7H16Cl2N2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride |
| SMILES | CN1CCCC2NCC21.Cl.Cl |
| InChI | InChI=1S/C7H14N2.2ClH/c1-9-4-2-3-6-7(9)5-8-6;;/h6-8H,2-5H2,1H3;2*1H |
| InChIKey | YFNSTMLEEIGWCO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride?
The IUPAC name of 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride (CID 135393059) is 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride.
What is the SMILES notation for 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride?
The canonical SMILES for 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride is CN1CCCC2NCC21.Cl.Cl.
What is the InChIKey of 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride?
The InChIKey is YFNSTMLEEIGWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2ClH/c1-9-4-2-3-6-7(9)5-8-6;;/h6-8H,2-5H2,1H3;2*1H.
What are the key properties of 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride?
2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride has a molecular weight of 199.12 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,7-diazabicyclo[4.2.0]octane;dihydrochloride is sourced from PubChem (CID 135393059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).