About 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one
6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 135393443) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one.
Molecular Properties
| Compound Name | 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one |
| PubChem CID | 135393443 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | Nc1ccc2c(c1)NC(=O)C21CCCCC1 |
| InChI | InChI=1S/C13H16N2O/c14-9-4-5-10-11(8-9)15-12(16)13(10)6-2-1-3-7-13/h4-5,8H,1-3,6-7,14H2,(H,15,16) |
| InChIKey | DOLVITNKAKWPKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one?
The IUPAC name of 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one (CID 135393443) is 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one.
What is the SMILES notation for 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one?
The canonical SMILES for 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one is Nc1ccc2c(c1)NC(=O)C21CCCCC1.
What is the InChIKey of 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one?
The InChIKey is DOLVITNKAKWPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c14-9-4-5-10-11(8-9)15-12(16)13(10)6-2-1-3-7-13/h4-5,8H,1-3,6-7,14H2,(H,15,16).
What are the key properties of 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one?
6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one has a molecular weight of 216.28 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminospiro[1H-indole-3,1'-cyclohexane]-2-one is sourced from PubChem (CID 135393443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).