C12H7N3O — CID 135393594
3,5,15-triazatricyclo[7.6.0.02,6]pentadeca-1(15),2,5,7,9,11,13-heptaen-4-one (PubChem CID 135393594) has the molecular formula C12H7N3O and a molecular weight of 209.21 g/mol. Its IUPAC name is 3,5,15-triazatricyclo[7.6.0.02,6]pentadeca-1(15),2,5,7,9,11,13-heptaen-4-one.
| Compound Name | 3,5,15-triazatricyclo[7.6.0.02,6]pentadeca-1(15),2,5,7,9,11,13-heptaen-4-one |
|---|---|
| PubChem CID | 135393594 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3,5,15-triazatricyclo[7.6.0.02,6]pentadeca-1(15),2,5,7,9,11,13-heptaen-4-one |
| SMILES | O=c1nc2ccc3cccccnc3c2n1 |
| InChI | InChI=1S/C12H7N3O/c16-12-14-9-6-5-8-4-2-1-3-7-13-10(8)11(9)15-12/h1-7H/b2-1-,3-1-,4-2-,7-3-,8-4-,13-7-,13-10+ |
| InChIKey | UTXOINLIKZWETM-LDXCPALTSA-N |
| XLogP | 1.54 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |