C11H10N4O — CID 135393604
2-amino-6-hydroxy-4-methylhepta-1,3,5-triene-1,1,3-tricarbonitrile (PubChem CID 135393604) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-amino-6-hydroxy-4-methylhepta-1,3,5-triene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-6-hydroxy-4-methylhepta-1,3,5-triene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 135393604 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-amino-6-hydroxy-4-methylhepta-1,3,5-triene-1,1,3-tricarbonitrile |
| SMILES | CC(O)=CC(C)=C(C#N)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C11H10N4O/c1-7(3-8(2)16)10(6-14)11(15)9(4-12)5-13/h3,16H,15H2,1-2H3 |
| InChIKey | RYBLETDZAIKMKV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|