About 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one
2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one (PubChem CID 135394128) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one |
| PubChem CID | 135394128 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one |
| SMILES | O=c1ccn2cc(CCl)[nH]c2c1 |
| InChI | InChI=1S/C8H7ClN2O/c9-4-6-5-11-2-1-7(12)3-8(11)10-6/h1-3,5,10H,4H2 |
| InChIKey | VVEQYVBWCXHESR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one?
The IUPAC name of 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one (CID 135394128) is 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one.
What is the SMILES notation for 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one?
The canonical SMILES for 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one is O=c1ccn2cc(CCl)[nH]c2c1.
What is the InChIKey of 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one?
The InChIKey is VVEQYVBWCXHESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c9-4-6-5-11-2-1-7(12)3-8(11)10-6/h1-3,5,10H,4H2.
What are the key properties of 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one?
2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one has a molecular weight of 182.61 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1H-imidazo[1,2-a]pyridin-7-one is sourced from PubChem (CID 135394128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).