C19H20N2O2 — CID 135394378
2-(2,5-dimethylpyrrol-1-yl)-5-[(4-methoxyphenyl)methoxy]pyridine (PubChem CID 135394378) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-5-[(4-methoxyphenyl)methoxy]pyridine.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-5-[(4-methoxyphenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 135394378 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-5-[(4-methoxyphenyl)methoxy]pyridine |
| SMILES | COc1ccc(COc2ccc(-n3c(C)ccc3C)nc2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-14-4-5-15(2)21(14)19-11-10-18(12-20-19)23-13-16-6-8-17(22-3)9-7-16/h4-12H,13H2,1-3H3 |
| InChIKey | XROVLBKNFDQMQJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|