C10H12BrNO2 — CID 135394785
3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylic acid (PubChem CID 135394785) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylic acid.
| Compound Name | 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 135394785 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylic acid |
| SMILES | O=C(O)C1=C2CCCCC2=CNC1Br |
| InChI | InChI=1S/C10H12BrNO2/c11-9-8(10(13)14)7-4-2-1-3-6(7)5-12-9/h5,9,12H,1-4H2,(H,13,14) |
| InChIKey | PWAYUPYJEAMKQY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|