C8H3Cl2FN2S — CID 135394943
2,4-dichloro-5-fluoro-6-thiophen-2-ylpyrimidine (PubChem CID 135394943) has the molecular formula C8H3Cl2FN2S and a molecular weight of 249.10 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-6-thiophen-2-ylpyrimidine.
| Compound Name | 2,4-dichloro-5-fluoro-6-thiophen-2-ylpyrimidine |
|---|---|
| PubChem CID | 135394943 |
| Molecular Formula | C8H3Cl2FN2S |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | 2,4-dichloro-5-fluoro-6-thiophen-2-ylpyrimidine |
| SMILES | Fc1c(Cl)nc(Cl)nc1-c1cccs1 |
| InChI | InChI=1S/C8H3Cl2FN2S/c9-7-5(11)6(12-8(10)13-7)4-2-1-3-14-4/h1-3H |
| InChIKey | PAMPGJWYDBVVKV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |