C17H10Br2 — CID 135397549
5,9-dibromo-7H-benzo[c]fluorene (PubChem CID 135397549) has the molecular formula C17H10Br2 and a molecular weight of 374.08 g/mol. Its IUPAC name is 5,9-dibromo-7H-benzo[c]fluorene.
| Compound Name | 5,9-dibromo-7H-benzo[c]fluorene |
|---|---|
| PubChem CID | 135397549 |
| Molecular Formula | C17H10Br2 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | 5,9-dibromo-7H-benzo[c]fluorene |
| SMILES | Brc1ccc2c(c1)Cc1cc(Br)c3ccccc3c1-2 |
| InChI | InChI=1S/C17H10Br2/c18-12-5-6-13-10(8-12)7-11-9-16(19)14-3-1-2-4-15(14)17(11)13/h1-6,8-9H,7H2 |
| InChIKey | APYYPHKAMCHWCF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |