About 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one
2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one (PubChem CID 135397847) has the molecular formula C19H16N4OS2
and a molecular weight of 380.50 g/mol. Its IUPAC name is 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one |
| PubChem CID | 135397847 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one |
| SMILES | O=c1[nH]c2nc(SCc3ccccc3)nc(SCc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C19H16N4OS2/c24-18-20-15-16(21-18)22-19(26-12-14-9-5-2-6-10-14)23-17(15)25-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H2,20,21,22,23,24) |
| InChIKey | XQHVEOYOXQXAEA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one?
The IUPAC name of 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one (CID 135397847) is 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one.
What is the SMILES notation for 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one?
The canonical SMILES for 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one is O=c1[nH]c2nc(SCc3ccccc3)nc(SCc3ccccc3)c2[nH]1.
What is the InChIKey of 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one?
The InChIKey is XQHVEOYOXQXAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4OS2/c24-18-20-15-16(21-18)22-19(26-12-14-9-5-2-6-10-14)23-17(15)25-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H2,20,21,22,23,24).
What are the key properties of 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one?
2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one has a molecular weight of 380.50 g/mol, XLogP of 4.23, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(benzylsulfanyl)-7,9-dihydropurin-8-one is sourced from PubChem (CID 135397847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).