C15H21O3- — CID 135397912
2-[(1R,3E,7E,10S)-10-hydroxy-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate (PubChem CID 135397912) has the molecular formula C15H21O3- and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-[(1R,3E,7E,10S)-10-hydroxy-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate.
| Compound Name | 2-[(1R,3E,7E,10S)-10-hydroxy-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135397912 |
| Molecular Formula | C15H21O3- |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-[(1R,3E,7E,10S)-10-hydroxy-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)[O-])[C@H]1C/C=C(\C)CC/C=C(\C)C[C@@H]1O |
| InChI | InChI=1S/C15H22O3/c1-10-5-4-6-11(2)9-14(16)13(8-7-10)12(3)15(17)18/h6-7,13-14,16H,3-5,8-9H2,1-2H3,(H,17,18)/p-1/b10-7+,11-6+/t13-,14+/m1/s1 |
| InChIKey | RSVUVHWOGWOXAY-IAJVGIPZSA-M |
| XLogP | 1.74 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|