C5H6N8 — CID 135398161
2-imidazo[1,2-b][1,2,4,5]tetrazin-3-ylguanidine (PubChem CID 135398161) has the molecular formula C5H6N8 and a molecular weight of 178.16 g/mol. Its IUPAC name is 2-imidazo[1,2-b][1,2,4,5]tetrazin-3-ylguanidine.
| Compound Name | 2-imidazo[1,2-b][1,2,4,5]tetrazin-3-ylguanidine |
|---|---|
| PubChem CID | 135398161 |
| Molecular Formula | C5H6N8 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-imidazo[1,2-b][1,2,4,5]tetrazin-3-ylguanidine |
| SMILES | NC(N)=Nc1nnc2nccn2n1 |
| InChI | InChI=1S/C5H6N8/c6-3(7)9-4-10-11-5-8-1-2-13(5)12-4/h1-2H,(H4,6,7,9,12) |
| InChIKey | PECPZLVXBPEOBV-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|