C8H6N6 — CID 135398167
3-pyrrol-1-ylimidazo[1,2-b][1,2,4,5]tetrazine (PubChem CID 135398167) has the molecular formula C8H6N6 and a molecular weight of 186.18 g/mol. Its IUPAC name is 3-pyrrol-1-ylimidazo[1,2-b][1,2,4,5]tetrazine.
| Compound Name | 3-pyrrol-1-ylimidazo[1,2-b][1,2,4,5]tetrazine |
|---|---|
| PubChem CID | 135398167 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-pyrrol-1-ylimidazo[1,2-b][1,2,4,5]tetrazine |
| SMILES | c1ccn(-c2nnc3nccn3n2)c1 |
| InChI | InChI=1S/C8H6N6/c1-2-5-13(4-1)8-11-10-7-9-3-6-14(7)12-8/h1-6H |
| InChIKey | TYOZZISGAQSLRD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |