C13H17ClN6 — CID 135398494
N-(5-tert-butyl-1H-pyrazol-3-yl)-2-chloro-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 135398494) has the molecular formula C13H17ClN6 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)-2-chloro-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine.
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-2-chloro-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 135398494 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-2-chloro-3,4a,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | CC(C)(C)c1cc(/N=C2\NC(Cl)=NC3NC=CC23)n[nH]1 |
| InChI | InChI=1S/C13H17ClN6/c1-13(2,3)8-6-9(20-19-8)16-11-7-4-5-15-10(7)17-12(14)18-11/h4-7,10,15H,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | SLXBZURUWREQQP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|