C14H8N2O8 — CID 135398668
4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid (PubChem CID 135398668) has the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. Its IUPAC name is 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid.
| Compound Name | 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
|---|---|
| PubChem CID | 135398668 |
| Molecular Formula | C14H8N2O8 |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4,5-dihydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
| SMILES | O=C(O)c1cc2c(O)c(O)c3[nH]c(C(=O)O)cc(C(=O)O)c3c2n1 |
| InChI | InChI=1S/C14H8N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,16-18H,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | QKZCLDGSTDNTDJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 181.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|