C4H2N8O4 — CID 135399032
5-nitro-3-(5-nitro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazole (PubChem CID 135399032) has the molecular formula C4H2N8O4 and a molecular weight of 226.11 g/mol. Its IUPAC name is 5-nitro-3-(5-nitro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazole.
| Compound Name | 5-nitro-3-(5-nitro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 135399032 |
| Molecular Formula | C4H2N8O4 |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5-nitro-3-(5-nitro-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(-c2n[nH]c([N+](=O)[O-])n2)n[nH]1 |
| InChI | InChI=1S/C4H2N8O4/c13-11(14)3-5-1(7-9-3)2-6-4(10-8-2)12(15)16/h(H,5,7,9)(H,6,8,10) |
| InChIKey | AHXZYSSGVZAEPX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|