About 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one
2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one (PubChem CID 135399209) has the molecular formula C12H12N2O5
and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one |
| PubChem CID | 135399209 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one |
| SMILES | O=C1OC(C(O)CO)C(O)=C1/N=N/c1ccccc1 |
| InChI | InChI=1S/C12H12N2O5/c15-6-8(16)11-10(17)9(12(18)19-11)14-13-7-4-2-1-3-5-7/h1-5,8,11,15-17H,6H2/b14-13+ |
| InChIKey | XSKSRYLDTLULCO-BUHFOSPRSA-N |
| XLogP | 0.82 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one?
The IUPAC name of 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one (CID 135399209) is 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one.
What is the SMILES notation for 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one?
The canonical SMILES for 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one is O=C1OC(C(O)CO)C(O)=C1/N=N/c1ccccc1.
What is the InChIKey of 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one?
The InChIKey is XSKSRYLDTLULCO-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H12N2O5/c15-6-8(16)11-10(17)9(12(18)19-11)14-13-7-4-2-1-3-5-7/h1-5,8,11,15-17H,6H2/b14-13+.
What are the key properties of 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one?
2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one has a molecular weight of 264.24 g/mol, XLogP of 0.82, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroxyethyl)-3-hydroxy-4-phenyldiazenyl-2H-furan-5-one is sourced from PubChem (CID 135399209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).