C16H19N3O2 — CID 135399531
2-(4-ethoxyanilino)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 135399531) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-(4-ethoxyanilino)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135399531 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(4-ethoxyanilino)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | CCOc1ccc(Nc2nc3c(c(=O)[nH]2)CCCC3)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-12-9-7-11(8-10-12)17-16-18-14-6-4-3-5-13(14)15(20)19-16/h7-10H,2-6H2,1H3,(H2,17,18,19,20) |
| InChIKey | GQQDPNUUUCFDAF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |