About (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one
(2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135399634) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one |
| PubChem CID | 135399634 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=C/c2nc3ccccc3o2)N1 |
| InChI | InChI=1S/C11H8N2O2S/c14-9-6-16-11(13-9)5-10-12-7-3-1-2-4-8(7)15-10/h1-5H,6H2,(H,13,14)/b11-5+ |
| InChIKey | MRJKHXFTRUAJBK-VZUCSPMQSA-N |
| XLogP | 1.99 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one (CID 135399634) is (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one is O=C1CS/C(=C/c2nc3ccccc3o2)N1.
What is the InChIKey of (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one?
The InChIKey is MRJKHXFTRUAJBK-VZUCSPMQSA-N. The full InChI is InChI=1S/C11H8N2O2S/c14-9-6-16-11(13-9)5-10-12-7-3-1-2-4-8(7)15-10/h1-5H,6H2,(H,13,14)/b11-5+.
What are the key properties of (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one?
(2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one has a molecular weight of 232.26 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(1,3-benzoxazol-2-ylmethylidene)-1,3-thiazolidin-4-one is sourced from PubChem (CID 135399634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).