C18H13N7 — CID 135399679
N-[(E)-1H-indol-3-ylmethylideneamino]-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine (PubChem CID 135399679) has the molecular formula C18H13N7 and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine |
|---|---|
| PubChem CID | 135399679 |
| Molecular Formula | C18H13N7 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-amine |
| SMILES | C(=N/Nc1ncnc2nn3ccccc3c12)\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H13N7/c1-2-6-14-13(5-1)12(9-19-14)10-22-23-17-16-15-7-3-4-8-25(15)24-18(16)21-11-20-17/h1-11,19H,(H,20,21,23,24)/b22-10+ |
| InChIKey | UIOJAFHWFVXULQ-LSHDLFTRSA-N |
| XLogP | 3.20 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|