About 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol
7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol (PubChem CID 135399711) has the molecular formula C22H14ClNO3
and a molecular weight of 375.81 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol.
Molecular Properties
| Compound Name | 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol |
| PubChem CID | 135399711 |
| Molecular Formula | C22H14ClNO3 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol |
| SMILES | Oc1ccc2c(c1)OCc1c-2nc2ccc(O)cc2c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H14ClNO3/c23-13-3-1-2-12(8-13)21-17-9-14(25)5-7-19(17)24-22-16-6-4-15(26)10-20(16)27-11-18(21)22/h1-10,25-26H,11H2 |
| InChIKey | LIAQMIXVDMWARY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The IUPAC name of 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol (CID 135399711) is 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol.
What is the SMILES notation for 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The canonical SMILES for 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol is Oc1ccc2c(c1)OCc1c-2nc2ccc(O)cc2c1-c1cccc(Cl)c1.
What is the InChIKey of 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The InChIKey is LIAQMIXVDMWARY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14ClNO3/c23-13-3-1-2-12(8-13)21-17-9-14(25)5-7-19(17)24-22-16-6-4-15(26)10-20(16)27-11-18(21)22/h1-10,25-26H,11H2.
What are the key properties of 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol has a molecular weight of 375.81 g/mol, XLogP of 5.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-chlorophenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol is sourced from PubChem (CID 135399711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).