About 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol
2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol (PubChem CID 135399781) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| PubChem CID | 135399781 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| SMILES | CC(C)[C@H]1COC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C12H15NO2/c1-8(2)10-7-15-12(13-10)9-5-3-4-6-11(9)14/h3-6,8,10,14H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | NHCHOCDSGYNNIS-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The IUPAC name of 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol (CID 135399781) is 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol.
What is the SMILES notation for 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The canonical SMILES for 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol is CC(C)[C@H]1COC(c2ccccc2O)=N1.
What is the InChIKey of 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The InChIKey is NHCHOCDSGYNNIS-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H15NO2/c1-8(2)10-7-15-12(13-10)9-5-3-4-6-11(9)14/h3-6,8,10,14H,7H2,1-2H3/t10-/m1/s1.
What are the key properties of 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol has a molecular weight of 205.26 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenol is sourced from PubChem (CID 135399781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).