C20H18N4S — CID 135399959
N,8-dimethyl-5-phenyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135399959) has the molecular formula C20H18N4S and a molecular weight of 346.46 g/mol. Its IUPAC name is N,8-dimethyl-5-phenyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | N,8-dimethyl-5-phenyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135399959 |
| Molecular Formula | C20H18N4S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N,8-dimethyl-5-phenyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2nc(C)ccc2C(c2ccccc2)=NC1c1cccs1 |
| InChI | InChI=1S/C20H18N4S/c1-13-10-11-15-17(14-7-4-3-5-8-14)23-18(16-9-6-12-25-16)20(21-2)24-19(15)22-13/h3-12,18H,1-2H3,(H,21,22,24) |
| InChIKey | OKVLPQWGPVCBRB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|