C16H17N5O2 — CID 135400104
N-(2-butyl-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide (PubChem CID 135400104) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-(2-butyl-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide.
| Compound Name | N-(2-butyl-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide |
|---|---|
| PubChem CID | 135400104 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(2-butyl-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)benzamide |
| SMILES | CCCCc1nc2[nH]c(=O)cc(NC(=O)c3ccccc3)n2n1 |
| InChI | InChI=1S/C16H17N5O2/c1-2-3-9-12-17-16-19-14(22)10-13(21(16)20-12)18-15(23)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3,(H,18,23)(H,17,19,20,22) |
| InChIKey | UOHLKXPMYRLWRU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |