C14H12N4OS — CID 135400184
2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one (PubChem CID 135400184) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one.
| Compound Name | 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135400184 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one |
| SMILES | Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccncc1 |
| InChI | InChI=1S/C14H12N4OS/c1-8-2-3-10-11(13(19)18-14(15)17-10)12(8)20-9-4-6-16-7-5-9/h2-7H,1H3,(H3,15,17,18,19) |
| InChIKey | XHWRWCSCBDLOLM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |