C13H11N3O3 — CID 135400282
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide (PubChem CID 135400282) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135400282 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)c1ccncc1 |
| InChI | InChI=1S/C13H11N3O3/c17-11-2-1-10(12(18)7-11)8-15-16-13(19)9-3-5-14-6-4-9/h1-8,17-18H,(H,16,19)/b15-8+ |
| InChIKey | CKBWTRSIUARPEC-OVCLIPMQSA-N |
| XLogP | 1.26 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|