C12H11N5O2 — CID 135400549
(NE)-N-[(4Z)-4-(phenylhydrazinylidene)-6,7-dihydro-2,1,3-benzoxadiazol-5-ylidene]hydroxylamine (PubChem CID 135400549) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is (NE)-N-[(4Z)-4-(phenylhydrazinylidene)-6,7-dihydro-2,1,3-benzoxadiazol-5-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4Z)-4-(phenylhydrazinylidene)-6,7-dihydro-2,1,3-benzoxadiazol-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135400549 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (NE)-N-[(4Z)-4-(phenylhydrazinylidene)-6,7-dihydro-2,1,3-benzoxadiazol-5-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCc2nonc2\C1=N/Nc1ccccc1 |
| InChI | InChI=1S/C12H11N5O2/c18-15-9-6-7-10-12(17-19-16-10)11(9)14-13-8-4-2-1-3-5-8/h1-5,13,18H,6-7H2/b14-11-,15-9+ |
| InChIKey | GFLIUWMYRGYJFD-UFRGALIOSA-N |
| XLogP | 1.66 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|