C16H13N5OS — CID 135400824
5-(furan-2-yl)-N-methyl-3-(1,3-thiazol-5-yl)-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135400824) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-methyl-3-(1,3-thiazol-5-yl)-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | 5-(furan-2-yl)-N-methyl-3-(1,3-thiazol-5-yl)-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135400824 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-(furan-2-yl)-N-methyl-3-(1,3-thiazol-5-yl)-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2ncccc2C(c2ccco2)=NC1c1cncs1 |
| InChI | InChI=1S/C16H13N5OS/c1-17-16-14(12-8-18-9-23-12)20-13(11-5-3-7-22-11)10-4-2-6-19-15(10)21-16/h2-9,14H,1H3,(H,17,19,21) |
| InChIKey | NCNQLCATACLVBU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|